C20H18N2O7S — CID 55340489
(4-methoxy-2-nitrophenyl) 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 55340489) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (4-methoxy-2-nitrophenyl) 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 55340489 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | COc1ccc(OC(=O)Cc2csc(-c3ccc(OC)c(OC)c3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N2O7S/c1-26-14-5-7-16(15(10-14)22(24)25)29-19(23)9-13-11-30-20(21-13)12-4-6-17(27-2)18(8-12)28-3/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | IEGIXCCKNBVOKD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|