C21H22N4O5S — CID 46401344
2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-(4-nitroanilino)ethyl]acetamide (PubChem CID 46401344) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-(4-nitroanilino)ethyl]acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-(4-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 46401344 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-(4-nitroanilino)ethyl]acetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)NCCNc3ccc([N+](=O)[O-])cc3)cs2)cc1OC |
| InChI | InChI=1S/C21H22N4O5S/c1-29-18-8-3-14(11-19(18)30-2)21-24-16(13-31-21)12-20(26)23-10-9-22-15-4-6-17(7-5-15)25(27)28/h3-8,11,13,22H,9-10,12H2,1-2H3,(H,23,26) |
| InChIKey | MAVOCALRELTXPB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|