C21H19N3O5S — CID 55483309
2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 55483309) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 55483309 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | COc1ccc(-c2nc(CC(=O)N3CCc4ccc([N+](=O)[O-])cc43)cs2)cc1OC |
| InChI | InChI=1S/C21H19N3O5S/c1-28-18-6-4-14(9-19(18)29-2)21-22-15(12-30-21)10-20(25)23-8-7-13-3-5-16(24(26)27)11-17(13)23/h3-6,9,11-12H,7-8,10H2,1-2H3 |
| InChIKey | JCRMZEVJYJERPU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|