C15H15N3O4 — CID 37161899
2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 37161899) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 37161899 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | Cc1noc(C)c1CC(=O)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H15N3O4/c1-9-13(10(2)22-16-9)8-15(19)17-6-5-11-3-4-12(18(20)21)7-14(11)17/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | VWMZTTAPJMYAIG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|