C17H13N3O3S2 — CID 37160835
1-(6-nitro-2,3-dihydroindol-1-yl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 37160835) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydroindol-1-yl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 37160835 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H13N3O3S2/c21-16(7-13-10-25-17(18-13)12-4-6-24-9-12)19-5-3-11-1-2-14(20(22)23)8-15(11)19/h1-2,4,6,8-10H,3,5,7H2 |
| InChIKey | NVXOREGJWQLUQF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|