C19H14FN3O3S2 — CID 112810680
2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 112810680) has the molecular formula C19H14FN3O3S2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 112810680 |
| Molecular Formula | C19H14FN3O3S2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CSc1nc(-c2ccc(F)cc2)cs1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H14FN3O3S2/c20-14-4-1-12(2-5-14)16-10-27-19(21-16)28-11-18(24)22-8-7-13-3-6-15(23(25)26)9-17(13)22/h1-6,9-10H,7-8,11H2 |
| InChIKey | UOWASNUYPYTQJQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|