C20H19N3O4 — CID 37161321
1-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]phenyl]pyrrolidin-2-one (PubChem CID 37161321) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 37161321 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(CC(=O)N2CCc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C20H19N3O4/c24-19-2-1-10-21(19)16-6-3-14(4-7-16)12-20(25)22-11-9-15-5-8-17(23(26)27)13-18(15)22/h3-8,13H,1-2,9-12H2 |
| InChIKey | ZIEIFXJZBNLZTI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|