C21H19N3O7S — CID 46660791
[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 46660791) has the molecular formula C21H19N3O7S and a molecular weight of 457.46 g/mol. Its IUPAC name is [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 46660791 |
| Molecular Formula | C21H19N3O7S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(-c2nc(C(=O)OCC(=O)Nc3ccc(C)c([N+](=O)[O-])c3)cs2)cc1OC |
| InChI | InChI=1S/C21H19N3O7S/c1-12-4-6-14(9-16(12)24(27)28)22-19(25)10-31-21(26)15-11-32-20(23-15)13-5-7-17(29-2)18(8-13)30-3/h4-9,11H,10H2,1-3H3,(H,22,25) |
| InChIKey | QZBLATGVVIJBGB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|