C18H12FN3O5S — CID 8824348
[2-(4-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 8824348) has the molecular formula C18H12FN3O5S and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 8824348 |
| Molecular Formula | C18H12FN3O5S |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1csc(-c2ccc(F)cc2)n1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12FN3O5S/c19-12-3-1-11(2-4-12)17-21-15(10-28-17)18(24)27-9-16(23)20-13-5-7-14(8-6-13)22(25)26/h1-8,10H,9H2,(H,20,23) |
| InChIKey | DKPOUWWQVNIGEA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|