C19H13FN2O5S — CID 8824379
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 8824379) has the molecular formula C19H13FN2O5S and a molecular weight of 400.39 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 8824379 |
| Molecular Formula | C19H13FN2O5S |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2csc(-c3ccc(F)cc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13FN2O5S/c1-11-2-3-13(8-16(11)22(25)26)17(23)9-27-19(24)15-10-28-18(21-15)12-4-6-14(20)7-5-12/h2-8,10H,9H2,1H3 |
| InChIKey | ZZNKXIHFHOFIBY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|