C11H13N3O4S — CID 96710262
6,7-diethoxy-4-nitro-1,3-benzothiazol-2-amine (PubChem CID 96710262) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 6,7-diethoxy-4-nitro-1,3-benzothiazol-2-amine.
| Compound Name | 6,7-diethoxy-4-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 96710262 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 6,7-diethoxy-4-nitro-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cc([N+](=O)[O-])c2nc(N)sc2c1OCC |
| InChI | InChI=1S/C11H13N3O4S/c1-3-17-7-5-6(14(15)16)8-10(9(7)18-4-2)19-11(12)13-8/h5H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | HUBPEPQATCVCSY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|