C21H19N3O4 — CID 110533971
2-(3,4-diethoxy-5-nitrophenyl)-1H-perimidine (PubChem CID 110533971) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-(3,4-diethoxy-5-nitrophenyl)-1H-perimidine.
| Compound Name | 2-(3,4-diethoxy-5-nitrophenyl)-1H-perimidine |
|---|---|
| PubChem CID | 110533971 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(3,4-diethoxy-5-nitrophenyl)-1H-perimidine |
| SMILES | CCOc1cc(C2=Nc3cccc4cccc(c34)N2)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C21H19N3O4/c1-3-27-18-12-14(11-17(24(25)26)20(18)28-4-2)21-22-15-9-5-7-13-8-6-10-16(23-21)19(13)15/h5-12H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | RRFQILQPLSFCHM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|