About 4-ethoxy-3-nitroaniline;hydrochloride
4-ethoxy-3-nitroaniline;hydrochloride (PubChem CID 171316041) has the molecular formula C8H11ClN2O3
and a molecular weight of 218.64 g/mol. Its IUPAC name is 4-ethoxy-3-nitroaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-ethoxy-3-nitroaniline;hydrochloride |
| PubChem CID | 171316041 |
| Molecular Formula | C8H11ClN2O3 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-ethoxy-3-nitroaniline;hydrochloride |
| SMILES | CCOc1ccc(N)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C8H10N2O3.ClH/c1-2-13-8-4-3-6(9)5-7(8)10(11)12;/h3-5H,2,9H2,1H3;1H |
| InChIKey | VUQZZQVFOONNPW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-3-nitroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-nitroaniline;hydrochloride?
The IUPAC name of 4-ethoxy-3-nitroaniline;hydrochloride (CID 171316041) is 4-ethoxy-3-nitroaniline;hydrochloride.
What is the SMILES notation for 4-ethoxy-3-nitroaniline;hydrochloride?
The canonical SMILES for 4-ethoxy-3-nitroaniline;hydrochloride is CCOc1ccc(N)cc1[N+](=O)[O-].Cl.
What is the InChIKey of 4-ethoxy-3-nitroaniline;hydrochloride?
The InChIKey is VUQZZQVFOONNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3.ClH/c1-2-13-8-4-3-6(9)5-7(8)10(11)12;/h3-5H,2,9H2,1H3;1H.
What are the key properties of 4-ethoxy-3-nitroaniline;hydrochloride?
4-ethoxy-3-nitroaniline;hydrochloride has a molecular weight of 218.64 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-nitroaniline;hydrochloride is sourced from PubChem (CID 171316041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).