About (4-amino-2-nitrophenyl) hypochlorite
(4-amino-2-nitrophenyl) hypochlorite (PubChem CID 172687565) has the molecular formula C6H5ClN2O3
and a molecular weight of 188.57 g/mol. Its IUPAC name is (4-amino-2-nitrophenyl) hypochlorite.
Molecular Properties
| Compound Name | (4-amino-2-nitrophenyl) hypochlorite |
| PubChem CID | 172687565 |
| Molecular Formula | C6H5ClN2O3 |
| Molecular Weight | 188.57 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | (4-amino-2-nitrophenyl) hypochlorite |
| SMILES | Nc1ccc(OCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H5ClN2O3/c7-12-6-2-1-4(8)3-5(6)9(10)11/h1-3H,8H2 |
| InChIKey | BFVQVRIDXAGTNJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-nitrophenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-nitrophenyl) hypochlorite?
The IUPAC name of (4-amino-2-nitrophenyl) hypochlorite (CID 172687565) is (4-amino-2-nitrophenyl) hypochlorite.
What is the SMILES notation for (4-amino-2-nitrophenyl) hypochlorite?
The canonical SMILES for (4-amino-2-nitrophenyl) hypochlorite is Nc1ccc(OCl)c([N+](=O)[O-])c1.
What is the InChIKey of (4-amino-2-nitrophenyl) hypochlorite?
The InChIKey is BFVQVRIDXAGTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O3/c7-12-6-2-1-4(8)3-5(6)9(10)11/h1-3H,8H2.
What are the key properties of (4-amino-2-nitrophenyl) hypochlorite?
(4-amino-2-nitrophenyl) hypochlorite has a molecular weight of 188.57 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-nitrophenyl) hypochlorite is sourced from PubChem (CID 172687565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).