About 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline
4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline (PubChem CID 157443998) has the molecular formula C24H20ClN3O4
and a molecular weight of 449.89 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline.
Molecular Properties
| Compound Name | 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline |
| PubChem CID | 157443998 |
| Molecular Formula | C24H20ClN3O4 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline |
| SMILES | Nc1ccc(Oc2ccccc2)c([N+](=O)[O-])c1.Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C12H10ClNO.C12H10N2O3/c13-11-3-1-2-4-12(11)15-10-7-5-9(14)6-8-10;13-9-6-7-12(11(8-9)14(15)16)17-10-4-2-1-3-5-10/h1-8H,14H2;1-8H,13H2 |
| InChIKey | BRZVKTJTLHTMLB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline?
The IUPAC name of 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline (CID 157443998) is 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline.
What is the SMILES notation for 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline?
The canonical SMILES for 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline is Nc1ccc(Oc2ccccc2)c([N+](=O)[O-])c1.Nc1ccc(Oc2ccccc2Cl)cc1.
What is the InChIKey of 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline?
The InChIKey is BRZVKTJTLHTMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO.C12H10N2O3/c13-11-3-1-2-4-12(11)15-10-7-5-9(14)6-8-10;13-9-6-7-12(11(8-9)14(15)16)17-10-4-2-1-3-5-10/h1-8H,14H2;1-8H,13H2.
What are the key properties of 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline?
4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline has a molecular weight of 449.89 g/mol, XLogP of 6.68, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenoxy)aniline;3-nitro-4-phenoxyaniline is sourced from PubChem (CID 157443998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).