C11H11ClN4O2S — CID 50881378
4-chloro-6-nitro-7-pyrrolidin-1-yl-1,3-benzothiazol-2-amine (PubChem CID 50881378) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.75 g/mol. Its IUPAC name is 4-chloro-6-nitro-7-pyrrolidin-1-yl-1,3-benzothiazol-2-amine.
| Compound Name | 4-chloro-6-nitro-7-pyrrolidin-1-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 50881378 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-chloro-6-nitro-7-pyrrolidin-1-yl-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(Cl)cc([N+](=O)[O-])c(N3CCCC3)c2s1 |
| InChI | InChI=1S/C11H11ClN4O2S/c12-6-5-7(16(17)18)9(15-3-1-2-4-15)10-8(6)14-11(13)19-10/h5H,1-4H2,(H2,13,14) |
| InChIKey | JZJCSCGSUQKKBZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|