C12H13N5O5 — CID 2836575
4-(azepan-1-yl)-5,7-dinitro-2,1,3-benzoxadiazole (PubChem CID 2836575) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol. Its IUPAC name is 4-(azepan-1-yl)-5,7-dinitro-2,1,3-benzoxadiazole.
| Compound Name | 4-(azepan-1-yl)-5,7-dinitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 2836575 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-(azepan-1-yl)-5,7-dinitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nonc2c1N1CCCCCC1 |
| InChI | InChI=1S/C12H13N5O5/c18-16(19)8-7-9(17(20)21)12(11-10(8)13-22-14-11)15-5-3-1-2-4-6-15/h7H,1-6H2 |
| InChIKey | VMJGZSSHFGKTQL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 128.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|