C12H14N4O4 — CID 80702708
4-methyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-ol (PubChem CID 80702708) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-methyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-ol.
| Compound Name | 4-methyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 80702708 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-methyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-ol |
| SMILES | CC1(O)CCN(c2ccc([N+](=O)[O-])c3nonc23)CC1 |
| InChI | InChI=1S/C12H14N4O4/c1-12(17)4-6-15(7-5-12)8-2-3-9(16(18)19)11-10(8)13-20-14-11/h2-3,17H,4-7H2,1H3 |
| InChIKey | JQLQMPIEBDHVEU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|