C13H17N5O3 — CID 81451632
3-ethyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-amine (PubChem CID 81451632) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-ethyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-amine.
| Compound Name | 3-ethyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 81451632 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-ethyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperidin-4-amine |
| SMILES | CCC1CN(c2ccc([N+](=O)[O-])c3nonc23)CCC1N |
| InChI | InChI=1S/C13H17N5O3/c1-2-8-7-17(6-5-9(8)14)10-3-4-11(18(19)20)13-12(10)15-21-16-13/h3-4,8-9H,2,5-7,14H2,1H3 |
| InChIKey | ACFLAOODOUZBKY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|