C12H13N5O3 — CID 60916144
7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-nitro-2,1,3-benzoxadiazole (PubChem CID 60916144) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-nitro-2,1,3-benzoxadiazole.
| Compound Name | 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 60916144 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 7-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-nitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CC3CNCC3C2)c2nonc12 |
| InChI | InChI=1S/C12H13N5O3/c18-17(19)10-2-1-9(11-12(10)15-20-14-11)16-5-7-3-13-4-8(7)6-16/h1-2,7-8,13H,3-6H2 |
| InChIKey | XUIYEXPFGIIKEG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|