C12H17N7O3 — CID 118930996
2-[4-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperazin-1-yl]ethylhydrazine (PubChem CID 118930996) has the molecular formula C12H17N7O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[4-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperazin-1-yl]ethylhydrazine.
| Compound Name | 2-[4-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperazin-1-yl]ethylhydrazine |
|---|---|
| PubChem CID | 118930996 |
| Molecular Formula | C12H17N7O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[4-(4-nitro-2,1,3-benzoxadiazol-7-yl)piperazin-1-yl]ethylhydrazine |
| SMILES | NNCCN1CCN(c2ccc([N+](=O)[O-])c3nonc23)CC1 |
| InChI | InChI=1S/C12H17N7O3/c13-14-3-4-17-5-7-18(8-6-17)9-1-2-10(19(20)21)12-11(9)15-22-16-12/h1-2,14H,3-8,13H2 |
| InChIKey | FVRRVQACVYREKU-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|