C10H10N4O5 — CID 106673485
1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-3,4-diol (PubChem CID 106673485) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is 1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673485 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(N2CC(O)C(O)C2)c2nonc12 |
| InChI | InChI=1S/C10H10N4O5/c15-7-3-13(4-8(7)16)5-1-2-6(14(17)18)10-9(5)11-19-12-10/h1-2,7-8,15-16H,3-4H2 |
| InChIKey | GTUUKRYPQMPYQI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|