C12H4N6O6S — CID 71764177
7-nitro-4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-2,1,3-benzoxadiazole (PubChem CID 71764177) has the molecular formula C12H4N6O6S and a molecular weight of 360.27 g/mol. Its IUPAC name is 7-nitro-4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-2,1,3-benzoxadiazole.
| Compound Name | 7-nitro-4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 71764177 |
| Molecular Formula | C12H4N6O6S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 7-nitro-4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc([N+](=O)[O-])c3nonc23)c2nonc12 |
| InChI | InChI=1S/C12H4N6O6S/c19-17(20)5-1-3-7(11-9(5)13-23-15-11)25-8-4-2-6(18(21)22)10-12(8)16-24-14-10/h1-4H |
| InChIKey | DNMPLRCZFMIDHW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 164.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|