C10H12N4O3 — CID 2836612
N,N-diethyl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 2836612) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is N,N-diethyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N,N-diethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 2836612 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | N,N-diethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C10H12N4O3/c1-3-13(4-2)7-5-6-8(14(15)16)10-9(7)11-17-12-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | DNINAOMAGDOEKK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|