About N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine
N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 97037317) has the molecular formula C9H9ClN4O3
and a molecular weight of 256.65 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| PubChem CID | 97037317 |
| Molecular Formula | C9H9ClN4O3 |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CN(CCCl)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C9H9ClN4O3/c1-13(5-4-10)6-2-3-7(14(15)16)9-8(6)11-17-12-9/h2-3H,4-5H2,1H3 |
| InChIKey | IKBYOXJPYRJUMY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The IUPAC name of N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (CID 97037317) is N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
What is the SMILES notation for N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The canonical SMILES for N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine is CN(CCCl)c1ccc([N+](=O)[O-])c2nonc12.
What is the InChIKey of N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The InChIKey is IKBYOXJPYRJUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4O3/c1-13(5-4-10)6-2-3-7(14(15)16)9-8(6)11-17-12-9/h2-3H,4-5H2,1H3.
What are the key properties of N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine has a molecular weight of 256.65 g/mol, XLogP of 1.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine is sourced from PubChem (CID 97037317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).