C12H4Cl2N6O6 — CID 159389274
4-chloro-7-nitro-2,1,3-benzoxadiazole (PubChem CID 159389274) has the molecular formula C12H4Cl2N6O6 and a molecular weight of 399.11 g/mol. Its IUPAC name is 4-chloro-7-nitro-2,1,3-benzoxadiazole.
| Compound Name | 4-chloro-7-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 159389274 |
| Molecular Formula | C12H4Cl2N6O6 |
| Molecular Weight | 399.11 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 4-chloro-7-nitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)c2nonc12.O=[N+]([O-])c1ccc(Cl)c2nonc12 |
| InChI | InChI=1S/2C6H2ClN3O3/c2*7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h2*1-2H |
| InChIKey | LLXDDVVJAKCPJS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 164.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.11 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|