C8H7N3O5 — CID 159002518
methane;4-nitro-2,1,3-benzoxadiazole-7-carboxylic acid (PubChem CID 159002518) has the molecular formula C8H7N3O5 and a molecular weight of 225.16 g/mol. Its IUPAC name is methane;4-nitro-2,1,3-benzoxadiazole-7-carboxylic acid.
| Compound Name | methane;4-nitro-2,1,3-benzoxadiazole-7-carboxylic acid |
|---|---|
| PubChem CID | 159002518 |
| Molecular Formula | C8H7N3O5 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | methane;4-nitro-2,1,3-benzoxadiazole-7-carboxylic acid |
| SMILES | C.O=C(O)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C7H3N3O5.CH4/c11-7(12)3-1-2-4(10(13)14)6-5(3)8-15-9-6;/h1-2H,(H,11,12);1H4 |
| InChIKey | JRMXMNFJMUJFLS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|