C10H10N4O6 — CID 101370134
(2R,3S)-3-hydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoic acid (PubChem CID 101370134) has the molecular formula C10H10N4O6 and a molecular weight of 282.21 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 101370134 |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoic acid |
| SMILES | C[C@H](O)[C@@H](Nc1ccc([N+](=O)[O-])c2nonc12)C(=O)O |
| InChI | InChI=1S/C10H10N4O6/c1-4(15)7(10(16)17)11-5-2-3-6(14(18)19)9-8(5)12-20-13-9/h2-4,7,11,15H,1H3,(H,16,17)/t4-,7+/m0/s1 |
| InChIKey | QXEFPJJGXBBIHJ-MHTLYPKNSA-N |
| XLogP | 0.38 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|