C11H9N5O3S — CID 63612753
4-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]-2,1,3-benzoxadiazol-7-amine (PubChem CID 63612753) has the molecular formula C11H9N5O3S and a molecular weight of 291.29 g/mol. Its IUPAC name is 4-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 63612753 |
| Molecular Formula | C11H9N5O3S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]-2,1,3-benzoxadiazol-7-amine |
| SMILES | CC(Nc1ccc([N+](=O)[O-])c2nonc12)c1nccs1 |
| InChI | InChI=1S/C11H9N5O3S/c1-6(11-12-4-5-20-11)13-7-2-3-8(16(17)18)10-9(7)14-19-15-10/h2-6,13H,1H3 |
| InChIKey | OALDDHADWARIAO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|