C13H15N3O4 — CID 159823876
2-methyl-6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexan-3-one (PubChem CID 159823876) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-methyl-6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexan-3-one.
| Compound Name | 2-methyl-6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexan-3-one |
|---|---|
| PubChem CID | 159823876 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-methyl-6-(4-nitro-2,1,3-benzoxadiazol-7-yl)hexan-3-one |
| SMILES | CC(C)C(=O)CCCc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C13H15N3O4/c1-8(2)11(17)5-3-4-9-6-7-10(16(18)19)13-12(9)14-20-15-13/h6-8H,3-5H2,1-2H3 |
| InChIKey | UOYLLNQLHFJDIH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|