C15H13FN4O3 — CID 174055453
N-ethyl-N-[(4-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 174055453) has the molecular formula C15H13FN4O3 and a molecular weight of 316.29 g/mol. Its IUPAC name is N-ethyl-N-[(4-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-ethyl-N-[(4-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 174055453 |
| Molecular Formula | C15H13FN4O3 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-ethyl-N-[(4-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCN(Cc1ccc(F)cc1)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C15H13FN4O3/c1-2-19(9-10-3-5-11(16)6-4-10)12-7-8-13(20(21)22)15-14(12)17-23-18-15/h3-8H,2,9H2,1H3 |
| InChIKey | DKLZCIPHQCFHDH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|