C17H13FN4O5 — CID 176901672
methyl N-(2-cyclopropyl-4-fluorophenyl)-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate (PubChem CID 176901672) has the molecular formula C17H13FN4O5 and a molecular weight of 372.31 g/mol. Its IUPAC name is methyl N-(2-cyclopropyl-4-fluorophenyl)-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate.
| Compound Name | methyl N-(2-cyclopropyl-4-fluorophenyl)-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate |
|---|---|
| PubChem CID | 176901672 |
| Molecular Formula | C17H13FN4O5 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | methyl N-(2-cyclopropyl-4-fluorophenyl)-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate |
| SMILES | COC(=O)N(c1ccc(F)cc1C1CC1)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C17H13FN4O5/c1-26-17(23)21(12-5-4-10(18)8-11(12)9-2-3-9)13-6-7-14(22(24)25)16-15(13)19-27-20-16/h4-9H,2-3H2,1H3 |
| InChIKey | AGORRBHTBDLUEK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|