C31H23F2N7O6 — CID 169103559
N-(2-cyclopropyl-4-fluorophenyl)-1-[4-(4-fluoro-1,3-dioxoisoindol-2-yl)butyl]-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrazole-4-carboxamide (PubChem CID 169103559) has the molecular formula C31H23F2N7O6 and a molecular weight of 627.56 g/mol. Its IUPAC name is N-(2-cyclopropyl-4-fluorophenyl)-1-[4-(4-fluoro-1,3-dioxoisoindol-2-yl)butyl]-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrazole-4-carboxamide.
| Compound Name | N-(2-cyclopropyl-4-fluorophenyl)-1-[4-(4-fluoro-1,3-dioxoisoindol-2-yl)butyl]-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169103559 |
| Molecular Formula | C31H23F2N7O6 |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | N-(2-cyclopropyl-4-fluorophenyl)-1-[4-(4-fluoro-1,3-dioxoisoindol-2-yl)butyl]-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrazole-4-carboxamide |
| SMILES | O=C1c2cccc(F)c2C(=O)N1CCCCn1cc(C(=O)N(c2ccc(F)cc2C2CC2)c2ccc([N+](=O)[O-])c3nonc23)cn1 |
| InChI | InChI=1S/C31H23F2N7O6/c32-19-8-9-23(21(14-19)17-6-7-17)39(24-10-11-25(40(44)45)28-27(24)35-46-36-28)29(41)18-15-34-37(16-18)12-1-2-13-38-30(42)20-4-3-5-22(33)26(20)31(38)43/h3-5,8-11,14-17H,1-2,6-7,12-13H2 |
| InChIKey | CKQBLIGLTCEEEF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 157.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|