C21H24N4O4 — CID 90622248
4-(1,3-dioxoisoindol-2-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide (PubChem CID 90622248) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 90622248 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1cnn(CC2CCOCC2)c1 |
| InChI | InChI=1S/C21H24N4O4/c26-19(23-16-12-22-24(14-16)13-15-7-10-29-11-8-15)6-3-9-25-20(27)17-4-1-2-5-18(17)21(25)28/h1-2,4-5,12,14-15H,3,6-11,13H2,(H,23,26) |
| InChIKey | VVLINHGGDIGYMY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|