C17H27N3O2S2 — CID 90622301
5-(dithiolan-3-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pentanamide (PubChem CID 90622301) has the molecular formula C17H27N3O2S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 90622301 |
| Molecular Formula | C17H27N3O2S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1cnn(CC2CCOCC2)c1 |
| InChI | InChI=1S/C17H27N3O2S2/c21-17(4-2-1-3-16-7-10-23-24-16)19-15-11-18-20(13-15)12-14-5-8-22-9-6-14/h11,13-14,16H,1-10,12H2,(H,19,21) |
| InChIKey | ITUDGMKPDIGQRN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|