C14H15N5O8 — CID 131953081
(3S)-4-(2-carboxyethylamino)-3-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-oxobutanoic acid (PubChem CID 131953081) has the molecular formula C14H15N5O8 and a molecular weight of 381.30 g/mol. Its IUPAC name is (3S)-4-(2-carboxyethylamino)-3-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-(2-carboxyethylamino)-3-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 131953081 |
| Molecular Formula | C14H15N5O8 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (3S)-4-(2-carboxyethylamino)-3-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-oxobutanoic acid |
| SMILES | CN(c1ccc([N+](=O)[O-])c2nonc12)[C@@H](CC(=O)O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H15N5O8/c1-18(9(6-11(22)23)14(24)15-5-4-10(20)21)7-2-3-8(19(25)26)13-12(7)16-27-17-13/h2-3,9H,4-6H2,1H3,(H,15,24)(H,20,21)(H,22,23)/t9-/m0/s1 |
| InChIKey | ZVCZBCQZSKITFI-VIFPVBQESA-N |
| XLogP | 0.00 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|