C21H22N8O4 — CID 101390685
N-[3-[(7-methyl-1,8-naphthyridin-2-yl)amino]propyl]-2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetamide (PubChem CID 101390685) has the molecular formula C21H22N8O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[3-[(7-methyl-1,8-naphthyridin-2-yl)amino]propyl]-2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetamide.
| Compound Name | N-[3-[(7-methyl-1,8-naphthyridin-2-yl)amino]propyl]-2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetamide |
|---|---|
| PubChem CID | 101390685 |
| Molecular Formula | C21H22N8O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-[(7-methyl-1,8-naphthyridin-2-yl)amino]propyl]-2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetamide |
| SMILES | Cc1ccc2ccc(NCCCNC(=O)CN(C)c3ccc([N+](=O)[O-])c4nonc34)nc2n1 |
| InChI | InChI=1S/C21H22N8O4/c1-13-4-5-14-6-9-17(25-21(14)24-13)22-10-3-11-23-18(30)12-28(2)15-7-8-16(29(31)32)20-19(15)26-33-27-20/h4-9H,3,10-12H2,1-2H3,(H,23,30)(H,22,24,25) |
| InChIKey | SORMALHHOISYSF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 152.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|