C18H21F2N3O2 — CID 145417322
ethane;2-fluoro-1-N-[(4-fluorophenyl)methyl]-4-nitro-1-N-prop-2-enylbenzene-1,3-diamine (PubChem CID 145417322) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is ethane;2-fluoro-1-N-[(4-fluorophenyl)methyl]-4-nitro-1-N-prop-2-enylbenzene-1,3-diamine.
| Compound Name | ethane;2-fluoro-1-N-[(4-fluorophenyl)methyl]-4-nitro-1-N-prop-2-enylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 145417322 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethane;2-fluoro-1-N-[(4-fluorophenyl)methyl]-4-nitro-1-N-prop-2-enylbenzene-1,3-diamine |
| SMILES | C=CCN(Cc1ccc(F)cc1)c1ccc([N+](=O)[O-])c(N)c1F.CC |
| InChI | InChI=1S/C16H15F2N3O2.C2H6/c1-2-9-20(10-11-3-5-12(17)6-4-11)13-7-8-14(21(22)23)16(19)15(13)18;1-2/h2-8H,1,9-10,19H2;1-2H3 |
| InChIKey | CSEAOBGLFWTFCO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|