About 1-fluoro-4-prop-2-enylbenzene;methanamine
1-fluoro-4-prop-2-enylbenzene;methanamine (PubChem CID 143096990) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-fluoro-4-prop-2-enylbenzene;methanamine.
Molecular Properties
| Compound Name | 1-fluoro-4-prop-2-enylbenzene;methanamine |
| PubChem CID | 143096990 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-fluoro-4-prop-2-enylbenzene;methanamine |
| SMILES | C=CCc1ccc(F)cc1.CN |
| InChI | InChI=1S/C9H9F.CH5N/c1-2-3-8-4-6-9(10)7-5-8;1-2/h2,4-7H,1,3H2;2H2,1H3 |
| InChIKey | GVXMCRVEZWTDEE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-prop-2-enylbenzene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-prop-2-enylbenzene;methanamine?
The IUPAC name of 1-fluoro-4-prop-2-enylbenzene;methanamine (CID 143096990) is 1-fluoro-4-prop-2-enylbenzene;methanamine.
What is the SMILES notation for 1-fluoro-4-prop-2-enylbenzene;methanamine?
The canonical SMILES for 1-fluoro-4-prop-2-enylbenzene;methanamine is C=CCc1ccc(F)cc1.CN.
What is the InChIKey of 1-fluoro-4-prop-2-enylbenzene;methanamine?
The InChIKey is GVXMCRVEZWTDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F.CH5N/c1-2-3-8-4-6-9(10)7-5-8;1-2/h2,4-7H,1,3H2;2H2,1H3.
What are the key properties of 1-fluoro-4-prop-2-enylbenzene;methanamine?
1-fluoro-4-prop-2-enylbenzene;methanamine has a molecular weight of 167.23 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-prop-2-enylbenzene;methanamine is sourced from PubChem (CID 143096990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).