C21H30FNO — CID 170631487
1-(4-fluorophenyl)-N-[3-(4-prop-2-enylphenyl)propyl]propan-2-amine;molecular hydrogen;hydrate (PubChem CID 170631487) has the molecular formula C21H30FNO and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(4-prop-2-enylphenyl)propyl]propan-2-amine;molecular hydrogen;hydrate.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(4-prop-2-enylphenyl)propyl]propan-2-amine;molecular hydrogen;hydrate |
|---|---|
| PubChem CID | 170631487 |
| Molecular Formula | C21H30FNO |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(4-prop-2-enylphenyl)propyl]propan-2-amine;molecular hydrogen;hydrate |
| SMILES | C=CCc1ccc(CCCNC(C)Cc2ccc(F)cc2)cc1.O.[H][H] |
| InChI | InChI=1S/C21H26FN.H2O.H2/c1-3-5-18-7-9-19(10-8-18)6-4-15-23-17(2)16-20-11-13-21(22)14-12-20;;/h3,7-14,17,23H,1,4-6,15-16H2,2H3;1H2;1H |
| InChIKey | YVEFKAOUHRUHTB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|