C18H23BrClN — CID 18790284
1-(4-bromophenyl)-N-(3-phenylpropyl)propan-2-amine;hydrochloride (PubChem CID 18790284) has the molecular formula C18H23BrClN and a molecular weight of 368.75 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(3-phenylpropyl)propan-2-amine;hydrochloride.
| Compound Name | 1-(4-bromophenyl)-N-(3-phenylpropyl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 18790284 |
| Molecular Formula | C18H23BrClN |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-(3-phenylpropyl)propan-2-amine;hydrochloride |
| SMILES | CC(Cc1ccc(Br)cc1)NCCCc1ccccc1.Cl |
| InChI | InChI=1S/C18H22BrN.ClH/c1-15(14-17-9-11-18(19)12-10-17)20-13-5-8-16-6-3-2-4-7-16;/h2-4,6-7,9-12,15,20H,5,8,13-14H2,1H3;1H |
| InChIKey | BAMGMZWJLYBBTK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|