C14H22BrNS — CID 103087520
N-[1-(4-bromophenyl)propan-2-yl]-4-methylsulfanylbutan-1-amine (PubChem CID 103087520) has the molecular formula C14H22BrNS and a molecular weight of 316.31 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propan-2-yl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[1-(4-bromophenyl)propan-2-yl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 103087520 |
| Molecular Formula | C14H22BrNS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[1-(4-bromophenyl)propan-2-yl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCNC(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrNS/c1-12(16-9-3-4-10-17-2)11-13-5-7-14(15)8-6-13/h5-8,12,16H,3-4,9-11H2,1-2H3 |
| InChIKey | JOQONKJACNVQOL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|