C13H20ClNS — CID 43694732
1-(3-chlorophenyl)-N-(3-methylsulfanylpropyl)propan-2-amine (PubChem CID 43694732) has the molecular formula C13H20ClNS and a molecular weight of 257.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(3-methylsulfanylpropyl)propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-(3-methylsulfanylpropyl)propan-2-amine |
|---|---|
| PubChem CID | 43694732 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(3-methylsulfanylpropyl)propan-2-amine |
| SMILES | CSCCCNC(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClNS/c1-11(15-7-4-8-16-2)9-12-5-3-6-13(14)10-12/h3,5-6,10-11,15H,4,7-9H2,1-2H3 |
| InChIKey | NTONLLMWUVCJTF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|