C26H26F2N2 — CID 141151305
1-[bis(4-fluorophenyl)methyl]-4-(4-prop-2-enylphenyl)piperazine (PubChem CID 141151305) has the molecular formula C26H26F2N2 and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methyl]-4-(4-prop-2-enylphenyl)piperazine.
| Compound Name | 1-[bis(4-fluorophenyl)methyl]-4-(4-prop-2-enylphenyl)piperazine |
|---|---|
| PubChem CID | 141151305 |
| Molecular Formula | C26H26F2N2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methyl]-4-(4-prop-2-enylphenyl)piperazine |
| SMILES | C=CCc1ccc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H26F2N2/c1-2-3-20-4-14-25(15-5-20)29-16-18-30(19-17-29)26(21-6-10-23(27)11-7-21)22-8-12-24(28)13-9-22/h2,4-15,26H,1,3,16-19H2 |
| InChIKey | BYXJPCHJAVFPBZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|