C25H30FN5 — CID 143935538
1-(1,2-diphenylethyl)-4-(4-fluorophenyl)piperazine;guanidine (PubChem CID 143935538) has the molecular formula C25H30FN5 and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(1,2-diphenylethyl)-4-(4-fluorophenyl)piperazine;guanidine.
| Compound Name | 1-(1,2-diphenylethyl)-4-(4-fluorophenyl)piperazine;guanidine |
|---|---|
| PubChem CID | 143935538 |
| Molecular Formula | C25H30FN5 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-(1,2-diphenylethyl)-4-(4-fluorophenyl)piperazine;guanidine |
| SMILES | Fc1ccc(N2CCN(C(Cc3ccccc3)c3ccccc3)CC2)cc1.[H]N=C(N)N |
| InChI | InChI=1S/C24H25FN2.CH5N3/c25-22-11-13-23(14-12-22)26-15-17-27(18-16-26)24(21-9-5-2-6-10-21)19-20-7-3-1-4-8-20;2-1(3)4/h1-14,24H,15-19H2;(H5,2,3,4) |
| InChIKey | DAWUGMUSAXKMDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|