C25H28N2 — CID 71276997
1-benzyl-4-[(1R)-1,2-diphenylethyl]piperazine (PubChem CID 71276997) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-benzyl-4-[(1R)-1,2-diphenylethyl]piperazine.
| Compound Name | 1-benzyl-4-[(1R)-1,2-diphenylethyl]piperazine |
|---|---|
| PubChem CID | 71276997 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-benzyl-4-[(1R)-1,2-diphenylethyl]piperazine |
| SMILES | c1ccc(C[C@H](c2ccccc2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N2/c1-4-10-22(11-5-1)20-25(24-14-8-3-9-15-24)27-18-16-26(17-19-27)21-23-12-6-2-7-13-23/h1-15,25H,16-21H2/t25-/m1/s1 |
| InChIKey | YUEIMYIILJBAOI-RUZDIDTESA-N |
| XLogP | 4.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |