C21H25N3S — CID 143935507
2-[4-(1,2-diphenylethyl)piperazin-1-yl]-4,5-dihydro-1,3-thiazole (PubChem CID 143935507) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is 2-[4-(1,2-diphenylethyl)piperazin-1-yl]-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[4-(1,2-diphenylethyl)piperazin-1-yl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 143935507 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[4-(1,2-diphenylethyl)piperazin-1-yl]-4,5-dihydro-1,3-thiazole |
| SMILES | c1ccc(CC(c2ccccc2)N2CCN(C3=NCCS3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3S/c1-3-7-18(8-4-1)17-20(19-9-5-2-6-10-19)23-12-14-24(15-13-23)21-22-11-16-25-21/h1-10,20H,11-17H2 |
| InChIKey | FNMMADPPULFREM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |