C23H30N2O2 — CID 143935537
2-methylpropyl 4-[(1S)-1,2-diphenylethyl]piperazine-1-carboxylate (PubChem CID 143935537) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-methylpropyl 4-[(1S)-1,2-diphenylethyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[(1S)-1,2-diphenylethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143935537 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-methylpropyl 4-[(1S)-1,2-diphenylethyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN([C@@H](Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-19(2)18-27-23(26)25-15-13-24(14-16-25)22(21-11-7-4-8-12-21)17-20-9-5-3-6-10-20/h3-12,19,22H,13-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | SGHJWACANBALBO-QFIPXVFZSA-N |
| XLogP | 4.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |