C21H29ClN2 — CID 54609342
N,N-dimethyl-4-(2-phenyl-1-piperidin-1-ylethyl)aniline;hydrochloride (PubChem CID 54609342) has the molecular formula C21H29ClN2 and a molecular weight of 344.93 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenyl-1-piperidin-1-ylethyl)aniline;hydrochloride.
| Compound Name | N,N-dimethyl-4-(2-phenyl-1-piperidin-1-ylethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 54609342 |
| Molecular Formula | C21H29ClN2 |
| Molecular Weight | 344.93 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N,N-dimethyl-4-(2-phenyl-1-piperidin-1-ylethyl)aniline;hydrochloride |
| SMILES | CN(C)c1ccc(C(Cc2ccccc2)N2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C21H28N2.ClH/c1-22(2)20-13-11-19(12-14-20)21(23-15-7-4-8-16-23)17-18-9-5-3-6-10-18;/h3,5-6,9-14,21H,4,7-8,15-17H2,1-2H3;1H |
| InChIKey | KQLFBLOZQLRFOJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.93 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|