C14H21N — CID 11321650
1-(1-phenylpropan-2-yl)piperidine (PubChem CID 11321650) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-(1-phenylpropan-2-yl)piperidine.
| Compound Name | 1-(1-phenylpropan-2-yl)piperidine |
|---|---|
| PubChem CID | 11321650 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-(1-phenylpropan-2-yl)piperidine |
| SMILES | CC(Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C14H21N/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2,4-5,8-9,13H,3,6-7,10-12H2,1H3 |
| InChIKey | TWIKIOOMYIVBAD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |